C17H19NO3 — CID 123653288
4,5-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-7,12,14,16-tetraene-6,13-diol (PubChem CID 123653288) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4,5-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-7,12,14,16-tetraene-6,13-diol.
| Compound Name | 4,5-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-7,12,14,16-tetraene-6,13-diol |
|---|---|
| PubChem CID | 123653288 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 4,5-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-7,12,14,16-tetraene-6,13-diol |
| SMILES | CC1N(C)C2CC34c5c2ccc(O)c5OC3CC=CC14O |
| InChI | InChI=1S/C17H19NO3/c1-9-17(20)7-3-4-13-16(17)8-11(18(9)2)10-5-6-12(19)15(21-13)14(10)16/h3,5-7,9,11,13,19-20H,4,8H2,1-2H3 |
| InChIKey | UJHBVPVGFIMBNF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|