C18H23NO4 — CID 70966225
(4R,4aS,12bS)-4a,9-dihydroxy-3,4,12-trimethyl-1,2,4,5,6,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-7-one (PubChem CID 70966225) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (4R,4aS,12bS)-4a,9-dihydroxy-3,4,12-trimethyl-1,2,4,5,6,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,12bS)-4a,9-dihydroxy-3,4,12-trimethyl-1,2,4,5,6,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 70966225 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (4R,4aS,12bS)-4a,9-dihydroxy-3,4,12-trimethyl-1,2,4,5,6,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-7-one |
| SMILES | Cc1ccc(O)c2c1[C@]13CCN(C)[C@H](C)[C@]1(O)CCC(=O)C3O2 |
| InChI | InChI=1S/C18H23NO4/c1-10-4-5-12(20)15-14(10)17-8-9-19(3)11(2)18(17,22)7-6-13(21)16(17)23-15/h4-5,11,16,20,22H,6-9H2,1-3H3/t11-,16?,17+,18-/m1/s1 |
| InChIKey | PKYKUPQBBFXYQC-VTUYSSFFSA-N |
| XLogP | 1.52 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |