C25H32N2O7 — CID 145322983
(2S)-6-(4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl)-2-formamido-5-oxohexanoic acid (PubChem CID 145322983) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is (2S)-6-(4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl)-2-formamido-5-oxohexanoic acid.
| Compound Name | (2S)-6-(4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl)-2-formamido-5-oxohexanoic acid |
|---|---|
| PubChem CID | 145322983 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (2S)-6-(4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl)-2-formamido-5-oxohexanoic acid |
| SMILES | Cc1ccc(O)c2c1C13CCN(C)C(C)C1(O)CC=C(CC(=O)CC[C@H](NC=O)C(=O)O)C3O2 |
| InChI | InChI=1S/C25H32N2O7/c1-14-4-7-19(30)21-20(14)24-10-11-27(3)15(2)25(24,33)9-8-16(22(24)34-21)12-17(29)5-6-18(23(31)32)26-13-28/h4,7-8,13,15,18,22,30,33H,5-6,9-12H2,1-3H3,(H,26,28)(H,31,32)/t15?,18-,22?,24?,25?/m0/s1 |
| InChIKey | XSEHEYUMHVJNSD-ZACVYUCJSA-N |
| XLogP | 1.42 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|