C44H61NO7 — CID 129184469
[(1S)-2-[[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] (E)-octadec-9-enoate (PubChem CID 129184469) has the molecular formula C44H61NO7 and a molecular weight of 715.97 g/mol. Its IUPAC name is [(1S)-2-[[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] (E)-octadec-9-enoate.
| Compound Name | [(1S)-2-[[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 129184469 |
| Molecular Formula | C44H61NO7 |
| Molecular Weight | 715.97 g/mol |
| Exact Mass | 715.44 |
| IUPAC Name | [(1S)-2-[[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)O[C@H](C(=O)OC1=CC[C@@]2(O)[C@@H](C)N(C)CC[C@@]23c2c(C)ccc(O)c2O[C@@H]13)c1ccccc1 |
| InChI | InChI=1S/C44H61NO7/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-25-37(47)51-39(34-23-20-19-21-24-34)42(48)50-36-28-29-44(49)33(3)45(4)31-30-43(44)38-32(2)26-27-35(46)40(38)52-41(36)43/h12-13,19-21,23-24,26-28,33,39,41,46,49H,5-11,14-18,22,25,29-31H2,1-4H3/b13-12+/t33-,39+,41+,43+,44-/m1/s1 |
| InChIKey | GBJWUNZHYJUVQK-KWQDBQCESA-N |
| XLogP | 9.31 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.97 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|