C37H52F3NO6 — CID 157460003
[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-octadec-9-enoate;2,2,2-trifluoroacetaldehyde (PubChem CID 157460003) has the molecular formula C37H52F3NO6 and a molecular weight of 663.82 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-octadec-9-enoate;2,2,2-trifluoroacetaldehyde.
| Compound Name | [(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-octadec-9-enoate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 157460003 |
| Molecular Formula | C37H52F3NO6 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.37 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-octadec-9-enoate;2,2,2-trifluoroacetaldehyde |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5.O=CC(F)(F)F |
| InChI | InChI=1S/C35H51NO5.C2HF3O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-30(38)40-28-21-22-35(39)29-25-26-19-20-27(37)32-31(26)34(35,33(28)41-32)23-24-36(29)2;3-2(4,5)1-6/h10-11,19-21,29,33,37,39H,3-9,12-18,22-25H2,1-2H3;1H/b11-10-;/t29-,33+,34+,35-;/m1./s1 |
| InChIKey | BTUQFRVGWYRNPU-HVJBXPSISA-N |
| XLogP | 8.00 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|