C36H53NO5 — CID 122670990
[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-octadec-9-enoate (PubChem CID 122670990) has the molecular formula C36H53NO5 and a molecular weight of 579.82 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-octadec-9-enoate.
| Compound Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 122670990 |
| Molecular Formula | C36H53NO5 |
| Molecular Weight | 579.82 g/mol |
| Exact Mass | 579.39 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C36H53NO5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-31(38)41-29-22-23-36(39)30-26-27-20-21-28(40-3)33-32(27)35(36,34(29)42-33)24-25-37(30)2/h11-12,20-22,30,34,39H,4-10,13-19,23-26H2,1-3H3/b12-11-/t30-,34+,35+,36-/m1/s1 |
| InChIKey | MCMPIYWUGZZGOD-SUERTPOHSA-N |
| XLogP | 7.55 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.82 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|