C28H37NO6 — CID 139441563
[(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-4a-pentanoyloxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] pentanoate (PubChem CID 139441563) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-4a-pentanoyloxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] pentanoate.
| Compound Name | [(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-4a-pentanoyloxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] pentanoate |
|---|---|
| PubChem CID | 139441563 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-4a-pentanoyloxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] pentanoate |
| SMILES | CCCCC(=O)OC1=CC[C@@]2(OC(=O)CCCC)[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C28H37NO6/c1-5-7-9-22(30)33-20-13-14-28(35-23(31)10-8-6-2)21-17-18-11-12-19(32-4)25-24(18)27(28,26(20)34-25)15-16-29(21)3/h11-13,21,26H,5-10,14-17H2,1-4H3/t21-,26+,27+,28-/m1/s1 |
| InChIKey | SKFLHZCAYZOMIM-OZBXUNDUSA-N |
| XLogP | 4.45 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |