C34H39NO9 — CID 129184200
1-O-[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-[(1S)-2-butoxy-2-oxo-1-phenylethyl] butanedioate (PubChem CID 129184200) has the molecular formula C34H39NO9 and a molecular weight of 605.68 g/mol. Its IUPAC name is 1-O-[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-[(1S)-2-butoxy-2-oxo-1-phenylethyl] butanedioate.
| Compound Name | 1-O-[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-[(1S)-2-butoxy-2-oxo-1-phenylethyl] butanedioate |
|---|---|
| PubChem CID | 129184200 |
| Molecular Formula | C34H39NO9 |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 1-O-[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-[(1S)-2-butoxy-2-oxo-1-phenylethyl] butanedioate |
| SMILES | CCCCOC(=O)[C@@H](OC(=O)CCC(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3C)[C@H]1O5)c1ccccc1 |
| InChI | InChI=1S/C34H39NO9/c1-4-5-19-41-32(38)29(21-9-7-6-8-10-21)43-27(37)14-13-26(36)42-24-15-16-34(39)25-20-22-11-12-23(40-3)30-28(22)33(34,31(24)44-30)17-18-35(25)2/h6-12,15,25,29,31,39H,4-5,13-14,16-20H2,1-3H3/t25-,29+,31+,33+,34-/m1/s1 |
| InChIKey | GEJXTBJYVNNRRZ-MGNMTNLZSA-N |
| XLogP | 3.92 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|