C30H40N2O7 — CID 129199096
[(4R,4aS,7aR,12bS)-3,9-dimethyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] butanoate (PubChem CID 129199096) has the molecular formula C30H40N2O7 and a molecular weight of 540.66 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-3,9-dimethyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] butanoate.
| Compound Name | [(4R,4aS,7aR,12bS)-3,9-dimethyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] butanoate |
|---|---|
| PubChem CID | 129199096 |
| Molecular Formula | C30H40N2O7 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-3,9-dimethyl-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyloxy]-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] butanoate |
| SMILES | CCCC(=O)O[C@@]12CC=C(OC(=O)CCNC(=O)OC(C)(C)C)[C@@H]3Oc4c(C)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C30H40N2O7/c1-7-8-23(34)38-30-13-11-20(36-22(33)12-15-31-27(35)39-28(3,4)5)26-29(30)14-16-32(6)21(30)17-19-10-9-18(2)25(37-26)24(19)29/h9-11,21,26H,7-8,12-17H2,1-6H3,(H,31,35)/t21-,26+,29+,30-/m1/s1 |
| InChIKey | IYKCWGIZXVCNKS-TTYMUKSTSA-N |
| XLogP | 4.08 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|