C26H34N2O6 — CID 129199107
4-O-[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-aminobutanedioate (PubChem CID 129199107) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-O-[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-aminobutanedioate.
| Compound Name | 4-O-[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-aminobutanedioate |
|---|---|
| PubChem CID | 129199107 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 4-O-[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-aminobutanedioate |
| SMILES | Cc1ccc2c3c1O[C@H]1C(OC(=O)C[C@H](N)C(=O)OC(C)(C)C)=CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C26H34N2O6/c1-14-6-7-15-12-18-26(31)9-8-17(32-19(29)13-16(27)23(30)34-24(2,3)4)22-25(26,10-11-28(18)5)20(15)21(14)33-22/h6-8,16,18,22,31H,9-13,27H2,1-5H3/t16-,18+,22-,25-,26+/m0/s1 |
| InChIKey | HZFFEAGGMMQOJS-XZYDSIFQSA-N |
| XLogP | 1.88 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |