C35H41NO8 — CID 122682162
4-O-[(1S)-2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] 1-O-tert-butyl (2S)-2-methylbutanedioate (PubChem CID 122682162) has the molecular formula C35H41NO8 and a molecular weight of 603.71 g/mol. Its IUPAC name is 4-O-[(1S)-2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] 1-O-tert-butyl (2S)-2-methylbutanedioate.
| Compound Name | 4-O-[(1S)-2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] 1-O-tert-butyl (2S)-2-methylbutanedioate |
|---|---|
| PubChem CID | 122682162 |
| Molecular Formula | C35H41NO8 |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 4-O-[(1S)-2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] 1-O-tert-butyl (2S)-2-methylbutanedioate |
| SMILES | Cc1ccc2c3c1O[C@H]1C(OC(=O)[C@@H](OC(=O)C[C@H](C)C(=O)OC(C)(C)C)c4ccccc4)=CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C35H41NO8/c1-20-12-13-23-19-25-35(40)15-14-24(30-34(35,16-17-36(25)6)27(23)28(20)43-30)41-32(39)29(22-10-8-7-9-11-22)42-26(37)18-21(2)31(38)44-33(3,4)5/h7-14,21,25,29-30,40H,15-19H2,1-6H3/t21-,25+,29-,30-,34-,35+/m0/s1 |
| InChIKey | NTMHDKWAAVOWIY-TUKDWCQNSA-N |
| XLogP | 4.47 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|