C29H37NO8 — CID 122682032
1-O-[(2S)-1-[[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl] 4-O-tert-butyl butanedioate (PubChem CID 122682032) has the molecular formula C29H37NO8 and a molecular weight of 527.61 g/mol. Its IUPAC name is 1-O-[(2S)-1-[[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl] 4-O-tert-butyl butanedioate.
| Compound Name | 1-O-[(2S)-1-[[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl] 4-O-tert-butyl butanedioate |
|---|---|
| PubChem CID | 122682032 |
| Molecular Formula | C29H37NO8 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 1-O-[(2S)-1-[[(4R,4aS,7aR,12bS)-4a-hydroxy-3,9-dimethyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl] 4-O-tert-butyl butanedioate |
| SMILES | Cc1ccc2c3c1O[C@H]1C(OC(=O)[C@H](C)OC(=O)CCC(=O)OC(C)(C)C)=CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C29H37NO8/c1-16-7-8-18-15-20-29(34)12-11-19(25-28(29,13-14-30(20)6)23(18)24(16)37-25)36-26(33)17(2)35-21(31)9-10-22(32)38-27(3,4)5/h7-8,11,17,20,25,34H,9-10,12-15H2,1-6H3/t17-,20+,25-,28-,29+/m0/s1 |
| InChIKey | YUUCSWHFCOYAQO-CIEXLQAGSA-N |
| XLogP | 2.87 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|