C34H47N3O10 — CID 122670605
(4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) 2-[3-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoyloxy]propanoate (PubChem CID 122670605) has the molecular formula C34H47N3O10 and a molecular weight of 657.76 g/mol. Its IUPAC name is (4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) 2-[3-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoyloxy]propanoate.
| Compound Name | (4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) 2-[3-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoyloxy]propanoate |
|---|---|
| PubChem CID | 122670605 |
| Molecular Formula | C34H47N3O10 |
| Molecular Weight | 657.76 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | (4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) 2-[3-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoyloxy]propanoate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)NCCC(=O)OC(C)C(=O)OC1=CCC2(O)C3Cc4ccc(O)c5c4C2(CCN3C)C1O5 |
| InChI | InChI=1S/C34H47N3O10/c1-18(2)16-21(36-31(42)47-32(4,5)6)29(40)35-14-11-25(39)44-19(3)30(41)45-23-10-12-34(43)24-17-20-8-9-22(38)27-26(20)33(34,28(23)46-27)13-15-37(24)7/h8-10,18-19,21,24,28,38,43H,11-17H2,1-7H3,(H,35,40)(H,36,42) |
| InChIKey | YQKWIXFSWGXGEO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 172.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.76 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|