C28H35NO9 — CID 122681706
4-O-[(4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-acetyloxybutanedioate (PubChem CID 122681706) has the molecular formula C28H35NO9 and a molecular weight of 529.59 g/mol. Its IUPAC name is 4-O-[(4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-acetyloxybutanedioate.
| Compound Name | 4-O-[(4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-acetyloxybutanedioate |
|---|---|
| PubChem CID | 122681706 |
| Molecular Formula | C28H35NO9 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 4-O-[(4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-acetyloxybutanedioate |
| SMILES | CC(=O)O[C@@H](CC(=O)OC1=CC[C@@]2(O)C3Cc4ccc(CO)c5c4[C@@]2(CCN3C)[C@H]1O5)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H35NO9/c1-15(31)35-19(25(33)38-26(2,3)4)13-21(32)36-18-8-9-28(34)20-12-16-6-7-17(14-30)23-22(16)27(28,24(18)37-23)10-11-29(20)5/h6-8,19-20,24,30,34H,9-14H2,1-5H3/t19-,20?,24-,27-,28+/m0/s1 |
| InChIKey | ZPUIBLHWTJSZQN-CACNUFJHSA-N |
| XLogP | 1.66 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|