C34H45NO11 — CID 122681732
ditert-butyl (2R)-2-[4-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobutanoyl]oxybutanedioate (PubChem CID 122681732) has the molecular formula C34H45NO11 and a molecular weight of 643.73 g/mol. Its IUPAC name is ditert-butyl (2R)-2-[4-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobutanoyl]oxybutanedioate.
| Compound Name | ditert-butyl (2R)-2-[4-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobutanoyl]oxybutanedioate |
|---|---|
| PubChem CID | 122681732 |
| Molecular Formula | C34H45NO11 |
| Molecular Weight | 643.73 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | ditert-butyl (2R)-2-[4-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobutanoyl]oxybutanedioate |
| SMILES | CN1CC[C@]23c4c5ccc(CO)c4O[C@H]2C(OC(=O)CCC(=O)O[C@H](CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)=CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C34H45NO11/c1-31(2,3)45-26(39)17-22(30(40)46-32(4,5)6)43-25(38)11-10-24(37)42-21-12-13-34(41)23-16-19-8-9-20(18-36)28-27(19)33(34,29(21)44-28)14-15-35(23)7/h8-9,12,22-23,29,36,41H,10-11,13-18H2,1-7H3/t22-,23-,29+,33+,34-/m1/s1 |
| InChIKey | MUBWPICLTGXKTP-IPKSRDOISA-N |
| XLogP | 2.77 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|