C25H32N2O7 — CID 122670548
4-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-aminobutanedioate (PubChem CID 122670548) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-aminobutanedioate.
| Compound Name | 4-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-aminobutanedioate |
|---|---|
| PubChem CID | 122670548 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-tert-butyl (2S)-2-aminobutanedioate |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(OC(=O)C[C@H](N)C(=O)OC(C)(C)C)=CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C25H32N2O7/c1-23(2,3)34-22(30)14(26)12-18(29)32-16-7-8-25(31)17-11-13-5-6-15(28)20-19(13)24(25,21(16)33-20)9-10-27(17)4/h5-7,14,17,21,28,31H,8-12,26H2,1-4H3/t14-,17+,21-,24-,25+/m0/s1 |
| InChIKey | AKJOPKRCXYHOHO-RSBSZLDYSA-N |
| XLogP | 1.27 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |