C37H55NO5 — CID 122683533
[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-icos-11-enoate (PubChem CID 122683533) has the molecular formula C37H55NO5 and a molecular weight of 593.85 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-icos-11-enoate.
| Compound Name | [(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 122683533 |
| Molecular Formula | C37H55NO5 |
| Molecular Weight | 593.85 g/mol |
| Exact Mass | 593.41 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (Z)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C37H55NO5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-32(40)42-30-23-24-37(41)31-27-28-21-22-29(39)34-33(28)36(37,35(30)43-34)25-26-38(31)2/h10-11,21-23,31,35,39,41H,3-9,12-20,24-27H2,1-2H3/b11-10-/t31-,35+,36+,37-/m1/s1 |
| InChIKey | NVGFJIYFNDUXJP-HNAPBYROSA-N |
| XLogP | 8.03 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.85 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|