C32H35NO11 — CID 129161685
1-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-phenyl butanedioate;2-acetyloxypropanoic acid (PubChem CID 129161685) has the molecular formula C32H35NO11 and a molecular weight of 609.63 g/mol. Its IUPAC name is 1-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-phenyl butanedioate;2-acetyloxypropanoic acid.
| Compound Name | 1-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-phenyl butanedioate;2-acetyloxypropanoic acid |
|---|---|
| PubChem CID | 129161685 |
| Molecular Formula | C32H35NO11 |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | 1-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 4-O-phenyl butanedioate;2-acetyloxypropanoic acid |
| SMILES | CC(=O)OC(C)C(=O)O.CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(OC(=O)CCC(=O)Oc2ccccc2)=CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C27H27NO7.C5H8O4/c1-28-14-13-26-23-16-7-8-18(29)24(23)35-25(26)19(11-12-27(26,32)20(28)15-16)34-22(31)10-9-21(30)33-17-5-3-2-4-6-17;1-3(5(7)8)9-4(2)6/h2-8,11,20,25,29,32H,9-10,12-15H2,1H3;3H,1-2H3,(H,7,8)/t20-,25+,26+,27-;/m1./s1 |
| InChIKey | VFUFTMQWTBZTOD-OKRPGNDBSA-N |
| XLogP | 2.62 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|