C34H37NO13 — CID 129161734
4-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-phenyl 2-acetyloxybutanedioate;2-acetyloxypropanoic acid (PubChem CID 129161734) has the molecular formula C34H37NO13 and a molecular weight of 667.66 g/mol. Its IUPAC name is 4-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-phenyl 2-acetyloxybutanedioate;2-acetyloxypropanoic acid.
| Compound Name | 4-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-phenyl 2-acetyloxybutanedioate;2-acetyloxypropanoic acid |
|---|---|
| PubChem CID | 129161734 |
| Molecular Formula | C34H37NO13 |
| Molecular Weight | 667.66 g/mol |
| Exact Mass | 667.23 |
| IUPAC Name | 4-O-[(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-phenyl 2-acetyloxybutanedioate;2-acetyloxypropanoic acid |
| SMILES | CC(=O)OC(C)C(=O)O.CC(=O)OC(CC(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C29H29NO9.C5H8O4/c1-16(31)36-21(27(34)37-18-6-4-3-5-7-18)15-23(33)38-20-10-11-29(35)22-14-17-8-9-19(32)25-24(17)28(29,26(20)39-25)12-13-30(22)2;1-3(5(7)8)9-4(2)6/h3-10,21-22,26,32,35H,11-15H2,1-2H3;3H,1-2H3,(H,7,8)/t21?,22-,26+,28+,29-;/m1./s1 |
| InChIKey | YPAHYSDALKVUDT-OWBVYQKNSA-N |
| XLogP | 2.16 |
| TPSA | 195.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.66 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|