C27H31NO11 — CID 129184204
(2S)-2-[(3S)-4-[[(4S,4aR,7aS,12bR)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-acetyloxy-4-oxobutanoyl]oxypropanoic acid (PubChem CID 129184204) has the molecular formula C27H31NO11 and a molecular weight of 545.54 g/mol. Its IUPAC name is (2S)-2-[(3S)-4-[[(4S,4aR,7aS,12bR)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-acetyloxy-4-oxobutanoyl]oxypropanoic acid.
| Compound Name | (2S)-2-[(3S)-4-[[(4S,4aR,7aS,12bR)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-acetyloxy-4-oxobutanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 129184204 |
| Molecular Formula | C27H31NO11 |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | (2S)-2-[(3S)-4-[[(4S,4aR,7aS,12bR)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-acetyloxy-4-oxobutanoyl]oxypropanoic acid |
| SMILES | COc1ccc2c3c1O[C@@H]1C(OC(=O)[C@H](CC(=O)O[C@@H](C)C(=O)O)OC(C)=O)=CC[C@]4(O)[C@H](C2)N(C)CC[C@@]314 |
| InChI | InChI=1S/C27H31NO11/c1-13(24(31)32)36-20(30)12-18(37-14(2)29)25(33)38-17-7-8-27(34)19-11-15-5-6-16(35-4)22-21(15)26(27,23(17)39-22)9-10-28(19)3/h5-7,13,18-19,23,34H,8-12H2,1-4H3,(H,31,32)/t13-,18-,19-,23+,26+,27-/m0/s1 |
| InChIKey | AQQKGWFVPDSLES-HTQCAYAMSA-N |
| XLogP | 0.85 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|