C24H26N2O8 — CID 129175338
(E)-4-[[3-[[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-oxopropyl]amino]-4-oxobut-2-enoic acid (PubChem CID 129175338) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is (E)-4-[[3-[[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-oxopropyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[3-[[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-oxopropyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 129175338 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (E)-4-[[3-[[(4R,4aS)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3-oxopropyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CN1CCC23c4c5ccc(O)c4OC2C(OC(=O)CCNC(=O)/C=C/C(=O)O)=CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C24H26N2O8/c1-26-11-9-23-20-13-2-3-14(27)21(20)34-22(23)15(6-8-24(23,32)16(26)12-13)33-19(31)7-10-25-17(28)4-5-18(29)30/h2-6,16,22,27,32H,7-12H2,1H3,(H,25,28)(H,29,30)/b5-4+/t16-,22?,23?,24-/m1/s1 |
| InChIKey | PISSIULMFXPGTN-HGOJPHJASA-N |
| XLogP | 0.36 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|