C23H26F3NO7 — CID 161441086
[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2S)-2-hydroxypropanoate;2,2,2-trifluoroacetaldehyde (PubChem CID 161441086) has the molecular formula C23H26F3NO7 and a molecular weight of 485.46 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2S)-2-hydroxypropanoate;2,2,2-trifluoroacetaldehyde.
| Compound Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2S)-2-hydroxypropanoate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 161441086 |
| Molecular Formula | C23H26F3NO7 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] (2S)-2-hydroxypropanoate;2,2,2-trifluoroacetaldehyde |
| SMILES | C[C@H](O)C(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(CO)c5c4[C@@]2(CCN3C)[C@H]1O5.O=CC(F)(F)F |
| InChI | InChI=1S/C21H25NO6.C2HF3O/c1-11(24)19(25)27-14-5-6-21(26)15-9-12-3-4-13(10-23)17-16(12)20(21,18(14)28-17)7-8-22(15)2;3-2(4,5)1-6/h3-5,11,15,18,23-24,26H,6-10H2,1-2H3;1H/t11-,15+,18-,20-,21+;/m0./s1 |
| InChIKey | VZHAMOQDHPFCRU-XBGNLSFMSA-N |
| XLogP | 1.13 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|