C25H27NO9 — CID 129175759
(E)-4-[(2S)-1-[[(4R,4aS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 129175759) has the molecular formula C25H27NO9 and a molecular weight of 485.49 g/mol. Its IUPAC name is (E)-4-[(2S)-1-[[(4R,4aS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(2S)-1-[[(4R,4aS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 129175759 |
| Molecular Formula | C25H27NO9 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (E)-4-[(2S)-1-[[(4R,4aS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-1-oxopropan-2-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | C[C@H](OC(=O)/C=C/C(=O)O)C(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(CO)c5c4C2(CCN3C)C1O5 |
| InChI | InChI=1S/C25H27NO9/c1-13(33-19(30)6-5-18(28)29)23(31)34-16-7-8-25(32)17-11-14-3-4-15(12-27)21-20(14)24(25,22(16)35-21)9-10-26(17)2/h3-7,13,17,22,27,32H,8-12H2,1-2H3,(H,28,29)/b6-5+/t13-,17+,22?,24?,25+/m0/s1 |
| InChIKey | UYBNYOCXLWGQOR-UIIGOBFKSA-N |
| XLogP | 0.57 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|