C26H29NO9 — CID 129175772
(2S)-2-[(E)-4-[[(4R,4aS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobut-2-enoyl]oxybutanoic acid (PubChem CID 129175772) has the molecular formula C26H29NO9 and a molecular weight of 499.52 g/mol. Its IUPAC name is (2S)-2-[(E)-4-[[(4R,4aS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobut-2-enoyl]oxybutanoic acid.
| Compound Name | (2S)-2-[(E)-4-[[(4R,4aS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobut-2-enoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 129175772 |
| Molecular Formula | C26H29NO9 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (2S)-2-[(E)-4-[[(4R,4aS)-4a-hydroxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-4-oxobut-2-enoyl]oxybutanoic acid |
| SMILES | CC[C@H](OC(=O)/C=C/C(=O)OC1=CC[C@@]2(O)[C@H]3Cc4ccc(CO)c5c4C2(CCN3C)C1O5)C(=O)O |
| InChI | InChI=1S/C26H29NO9/c1-3-16(24(31)32)34-19(29)6-7-20(30)35-17-8-9-26(33)18-12-14-4-5-15(13-28)22-21(14)25(26,23(17)36-22)10-11-27(18)2/h4-8,16,18,23,28,33H,3,9-13H2,1-2H3,(H,31,32)/b7-6+/t16-,18+,23?,25?,26+/m0/s1 |
| InChIKey | SVXXYOLTZPIBTC-QOFRRJCYSA-N |
| XLogP | 0.96 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|