C32H37NO9 — CID 129176912
[(1S)-2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] (2S)-2-acetyloxypropanoate (PubChem CID 129176912) has the molecular formula C32H37NO9 and a molecular weight of 579.65 g/mol. Its IUPAC name is [(1S)-2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] (2S)-2-acetyloxypropanoate.
| Compound Name | [(1S)-2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] (2S)-2-acetyloxypropanoate |
|---|---|
| PubChem CID | 129176912 |
| Molecular Formula | C32H37NO9 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | [(1S)-2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-(hydroxymethyl)-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxo-1-phenylethyl] (2S)-2-acetyloxypropanoate |
| SMILES | CC(=O)O[C@@H](C)C(=O)O[C@H](C(=O)OC1=CC[C@@]2(O)[C@@H](C)N(C)CC[C@@]23c2c(C)ccc(CO)c2O[C@@H]13)c1ccccc1 |
| InChI | InChI=1S/C32H37NO9/c1-18-11-12-23(17-34)26-25(18)31-15-16-33(5)20(3)32(31,38)14-13-24(28(31)41-26)40-30(37)27(22-9-7-6-8-10-22)42-29(36)19(2)39-21(4)35/h6-13,19-20,27-28,34,38H,14-17H2,1-5H3/t19-,20+,27-,28-,31-,32+/m0/s1 |
| InChIKey | MOGFZCWHOFXHOI-DXUPJPRNSA-N |
| XLogP | 3.01 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|