C32H45N2O6P — CID 145322984
1-(4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl)-4-(methylamino)butan-2-one;ethane;formyl(phenyl)phosphinous acid (PubChem CID 145322984) has the molecular formula C32H45N2O6P and a molecular weight of 584.69 g/mol. Its IUPAC name is 1-(4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl)-4-(methylamino)butan-2-one;ethane;formyl(phenyl)phosphinous acid.
| Compound Name | 1-(4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl)-4-(methylamino)butan-2-one;ethane;formyl(phenyl)phosphinous acid |
|---|---|
| PubChem CID | 145322984 |
| Molecular Formula | C32H45N2O6P |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 1-(4a,9-dihydroxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl)-4-(methylamino)butan-2-one;ethane;formyl(phenyl)phosphinous acid |
| SMILES | CC.CNCCC(=O)CC1=CCC2(O)C(C)N(C)CCC23c2c(C)ccc(O)c2OC13.O=CP(O)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O4.C7H7O2P.C2H6/c1-14-5-6-18(27)20-19(14)22-10-12-25(4)15(2)23(22,28)9-7-16(21(22)29-20)13-17(26)8-11-24-3;8-6-10(9)7-4-2-1-3-5-7;1-2/h5-7,15,21,24,27-28H,8-13H2,1-4H3;1-6,9H;1-2H3 |
| InChIKey | GJQFAMCYFJUQNR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|