C19H21NO3 — CID 58296563
[(4R,12bS)-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]methanol (PubChem CID 58296563) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [(4R,12bS)-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]methanol.
| Compound Name | [(4R,12bS)-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]methanol |
|---|---|
| PubChem CID | 58296563 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(4R,12bS)-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]methanol |
| SMILES | COC1=CC=C2[C@H]3Cc4ccc(CO)c5c4[C@@]2(CCN3C)C1O5 |
| InChI | InChI=1S/C19H21NO3/c1-20-8-7-19-13-5-6-15(22-2)18(19)23-17-12(10-21)4-3-11(16(17)19)9-14(13)20/h3-6,14,18,21H,7-10H2,1-2H3/t14-,18?,19+/m1/s1 |
| InChIKey | VRKRJILYOQKUFW-ONZWQQIVSA-N |
| XLogP | 1.91 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |