C19H21NO — CID 58049290
(12bS)-3,7,9-trimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 58049290) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (12bS)-3,7,9-trimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (12bS)-3,7,9-trimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 58049290 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (12bS)-3,7,9-trimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | CC1=CC=C2C3Cc4ccc(C)c5c4[C@@]2(CCN3C)C1O5 |
| InChI | InChI=1S/C19H21NO/c1-11-4-6-13-10-15-14-7-5-12(2)18-19(14,8-9-20(15)3)16(13)17(11)21-18/h4-7,15,18H,8-10H2,1-3H3/t15?,18?,19-/m0/s1 |
| InChIKey | IECZBVFJTYLJJR-PPSBMQLTSA-N |
| XLogP | 3.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |