C23H27NO — CID 58111482
(4S,7aR,12bR)-3-(cyclobutylmethyl)-7,9-dimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 58111482) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (4S,7aR,12bR)-3-(cyclobutylmethyl)-7,9-dimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4S,7aR,12bR)-3-(cyclobutylmethyl)-7,9-dimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 58111482 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (4S,7aR,12bR)-3-(cyclobutylmethyl)-7,9-dimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | CC1=CC=C2[C@@H]3Cc4ccc(C)c5c4[C@]2(CCN3CC2CCC2)[C@@H]1O5 |
| InChI | InChI=1S/C23H27NO/c1-14-6-8-17-12-19-18-9-7-15(2)22-23(18,20(17)21(14)25-22)10-11-24(19)13-16-4-3-5-16/h6-9,16,19,22H,3-5,10-13H2,1-2H3/t19-,22+,23+/m0/s1 |
| InChIKey | NPICVTSKTMXVMO-WWPVKYPJSA-N |
| XLogP | 4.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |