C20H22O — CID 170370348
(1S,5R,13S)-14-ethyl-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14,16-pentaene (PubChem CID 170370348) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is (1S,5R,13S)-14-ethyl-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14,16-pentaene.
| Compound Name | (1S,5R,13S)-14-ethyl-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14,16-pentaene |
|---|---|
| PubChem CID | 170370348 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (1S,5R,13S)-14-ethyl-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14,16-pentaene |
| SMILES | CCC1=CC=C2[C@@H]3CCC[C@@]24c2c(ccc(C)c2O[C@@H]14)C3 |
| InChI | InChI=1S/C20H22O/c1-3-13-8-9-16-14-5-4-10-20(16)17-15(11-14)7-6-12(2)18(17)21-19(13)20/h6-9,14,19H,3-5,10-11H2,1-2H3/t14-,19+,20+/m1/s1 |
| InChIKey | CPHGMSQIEHLUQL-UAOJZALGSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |