C18H20O — CID 91575394
10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraene (PubChem CID 91575394) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is 10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraene.
| Compound Name | 10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraene |
|---|---|
| PubChem CID | 91575394 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,14-tetraene |
| SMILES | Cc1ccc2c3c1OC1C=CCC4C(CCCC314)C2 |
| InChI | InChI=1S/C18H20O/c1-11-7-8-13-10-12-4-3-9-18-14(12)5-2-6-15(18)19-17(11)16(13)18/h2,6-8,12,14-15H,3-5,9-10H2,1H3 |
| InChIKey | RCDOANQDUYIFJI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|