C17H18O — CID 154963064
(1S,5R)-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraene (PubChem CID 154963064) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is (1S,5R)-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraene.
| Compound Name | (1S,5R)-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraene |
|---|---|
| PubChem CID | 154963064 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (1S,5R)-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraene |
| SMILES | C1=CC2[C@@H]3CCC[C@@]24c2c(cccc2OC4C1)C3 |
| InChI | InChI=1S/C17H18O/c1-4-12-10-11-5-3-9-17-13(11)6-2-8-15(17)18-14(7-1)16(12)17/h1-2,4,6-7,11,13,15H,3,5,8-10H2/t11-,13?,15?,17-/m1/s1 |
| InChIKey | NCRIKBQBZVFGEE-WWJKNXHQSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|