C17H21NO — CID 70598159
(4R,4aR,6S,7aS,12bS)-6-methyl-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 70598159) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (4R,4aR,6S,7aS,12bS)-6-methyl-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,4aR,6S,7aS,12bS)-6-methyl-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 70598159 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (4R,4aR,6S,7aS,12bS)-6-methyl-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | C[C@@H]1C[C@@H]2Oc3cccc4c3[C@@]23CCN[C@H](C4)[C@@H]3C1 |
| InChI | InChI=1S/C17H21NO/c1-10-7-12-13-9-11-3-2-4-14-16(11)17(12,5-6-18-13)15(8-10)19-14/h2-4,10,12-13,15,18H,5-9H2,1H3/t10-,12-,13+,15-,17+/m0/s1 |
| InChIKey | QYTGHIOTEXXLPX-WLCGFPEOSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |