C25H39NO4 — CID 143747762
(6S,7aR)-6-(2-hydroxy-3,3-dimethylbutan-2-yl)-7-methoxy-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;ethane (PubChem CID 143747762) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is (6S,7aR)-6-(2-hydroxy-3,3-dimethylbutan-2-yl)-7-methoxy-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;ethane.
| Compound Name | (6S,7aR)-6-(2-hydroxy-3,3-dimethylbutan-2-yl)-7-methoxy-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;ethane |
|---|---|
| PubChem CID | 143747762 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (6S,7aR)-6-(2-hydroxy-3,3-dimethylbutan-2-yl)-7-methoxy-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;ethane |
| SMILES | CC.COC1[C@@H]2Oc3c(O)ccc4c3C23CCNC(C4)C3C[C@@H]1C(C)(O)C(C)(C)C |
| InChI | InChI=1S/C23H33NO4.C2H6/c1-21(2,3)22(4,26)14-11-13-15-10-12-6-7-16(25)19-17(12)23(13,8-9-24-15)20(28-19)18(14)27-5;1-2/h6-7,13-15,18,20,24-26H,8-11H2,1-5H3;1-2H3/t13?,14-,15?,18?,20-,22?,23?;/m0./s1 |
| InChIKey | WLMFMJKAKHEHEJ-UHVIIAJXSA-N |
| XLogP | 3.78 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |