C18H22N2O3 — CID 71175479
N-[(7S,7aR)-9-hydroxy-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]acetamide (PubChem CID 71175479) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is N-[(7S,7aR)-9-hydroxy-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]acetamide.
| Compound Name | N-[(7S,7aR)-9-hydroxy-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]acetamide |
|---|---|
| PubChem CID | 71175479 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[(7S,7aR)-9-hydroxy-1,2,3,4,4a,5,6,7,7a,13-decahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CCC2C3Cc4ccc(O)c5c4C2(CCN3)[C@H]1O5 |
| InChI | InChI=1S/C18H22N2O3/c1-9(21)20-12-4-3-11-13-8-10-2-5-14(22)16-15(10)18(11,6-7-19-13)17(12)23-16/h2,5,11-13,17,19,22H,3-4,6-8H2,1H3,(H,20,21)/t11?,12-,13?,17-,18?/m0/s1 |
| InChIKey | ZITRIDUVGZVMMF-PNTIYJCRSA-N |
| XLogP | 1.22 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |