C18H21NO3 — CID 174493178
(4R,4aR,7aS,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-carbaldehyde (PubChem CID 174493178) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (4R,4aR,7aS,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-carbaldehyde.
| Compound Name | (4R,4aR,7aS,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 174493178 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (4R,4aR,7aS,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-carbaldehyde |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(C=O)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C18H21NO3/c1-19-7-6-18-12-4-2-11(9-20)17(18)22-16-14(21)5-3-10(15(16)18)8-13(12)19/h3,5,9,11-13,17,21H,2,4,6-8H2,1H3/t11?,12-,13+,17-,18-/m0/s1 |
| InChIKey | XFOMSVTZJOWKAE-PZSFTQSMSA-N |
| XLogP | 1.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|