C23H35NO3Si — CID 154193357
(4S,4aS,7S,7aS,12bR)-7-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol (PubChem CID 154193357) has the molecular formula C23H35NO3Si and a molecular weight of 401.62 g/mol. Its IUPAC name is (4S,4aS,7S,7aS,12bR)-7-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol.
| Compound Name | (4S,4aS,7S,7aS,12bR)-7-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
|---|---|
| PubChem CID | 154193357 |
| Molecular Formula | C23H35NO3Si |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (4S,4aS,7S,7aS,12bR)-7-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
| SMILES | CN1CC[C@@]23c4c5ccc(O)c4O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]3[C@@H]1C5 |
| InChI | InChI=1S/C23H35NO3Si/c1-22(2,3)28(5,6)27-18-10-8-15-16-13-14-7-9-17(25)20-19(14)23(15,21(18)26-20)11-12-24(16)4/h7,9,15-16,18,21,25H,8,10-13H2,1-6H3/t15-,16+,18+,21-,23-/m1/s1 |
| InChIKey | VYNIBXRGPHJFDC-RSBMDPRMSA-N |
| XLogP | 4.45 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|