C23H30N2O6 — CID 67605312
ethyl 3-[[(4R,4aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxycarbonylamino]propanoate (PubChem CID 67605312) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is ethyl 3-[[(4R,4aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxycarbonylamino]propanoate.
| Compound Name | ethyl 3-[[(4R,4aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 67605312 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | ethyl 3-[[(4R,4aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)OC1CC[C@H]2[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)C1O5 |
| InChI | InChI=1S/C23H30N2O6/c1-3-29-18(27)8-10-24-22(28)30-17-7-5-14-15-12-13-4-6-16(26)20-19(13)23(14,21(17)31-20)9-11-25(15)2/h4,6,14-15,17,21,26H,3,5,7-12H2,1-2H3,(H,24,28)/t14-,15+,17?,21?,23-/m0/s1 |
| InChIKey | JKTOKFKYHRTNTQ-LWYZJNDOSA-N |
| XLogP | 2.11 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |