C22H27NO6 — CID 71181554
4-[(7S,7aR)-7-acetyloxy-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]butanoic acid (PubChem CID 71181554) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-[(7S,7aR)-7-acetyloxy-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]butanoic acid.
| Compound Name | 4-[(7S,7aR)-7-acetyloxy-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 71181554 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[(7S,7aR)-7-acetyloxy-9-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]butanoic acid |
| SMILES | CC(=O)O[C@H]1CCC2C3Cc4ccc(O)c5c4C2(CCN3CCCC(=O)O)[C@H]1O5 |
| InChI | InChI=1S/C22H27NO6/c1-12(24)28-17-7-5-14-15-11-13-4-6-16(25)20-19(13)22(14,21(17)29-20)8-10-23(15)9-2-3-18(26)27/h4,6,14-15,17,21,25H,2-3,5,7-11H2,1H3,(H,26,27)/t14?,15?,17-,21-,22?/m0/s1 |
| InChIKey | RLZPXWDEKFSLKG-BQGPWBQPSA-N |
| XLogP | 2.23 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |