C24H27NO7 — CID 157498719
4-[(4aR,7S,7aR,12bS)-7,9-diacetyloxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]butanoic acid (PubChem CID 157498719) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is 4-[(4aR,7S,7aR,12bS)-7,9-diacetyloxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]butanoic acid.
| Compound Name | 4-[(4aR,7S,7aR,12bS)-7,9-diacetyloxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 157498719 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-[(4aR,7S,7aR,12bS)-7,9-diacetyloxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-yl]butanoic acid |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](OC(C)=O)C=C[C@H]4C(C2)N(CCCC(=O)O)CC[C@@]341 |
| InChI | InChI=1S/C24H27NO7/c1-13(26)30-18-7-5-15-12-17-16-6-8-19(31-14(2)27)23-24(16,21(15)22(18)32-23)9-11-25(17)10-3-4-20(28)29/h5-8,16-17,19,23H,3-4,9-12H2,1-2H3,(H,28,29)/t16-,17?,19-,23-,24-/m0/s1 |
| InChIKey | CGHYWTXOTCXRCT-FSACQUTJSA-N |
| XLogP | 2.22 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|