C23H27BN2O6P — CID 174067485
CID 174067485 (PubChem CID 174067485) has the molecular formula C23H27BN2O6P and a molecular weight of 469.26 g/mol.
| Compound Name | CID 174067485 |
|---|---|
| PubChem CID | 174067485 |
| Molecular Formula | C23H27BN2O6P |
| Molecular Weight | 469.26 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | — |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](OC(C)=O)C=C[C@H]4C(C2)N(CC[B]C(=O)NP)CC[C@@]341 |
| InChI | InChI=1S/C23H27BN2O6P/c1-12(27)30-17-5-3-14-11-16-15-4-6-18(31-13(2)28)21-23(15,19(14)20(17)32-21)7-9-26(16)10-8-24-22(29)25-33/h3-6,15-16,18,21H,7-11,33H2,1-2H3,(H,25,29)/t15-,16?,18-,21-,23-/m0/s1 |
| InChIKey | HUYCGEWXKGNDHN-HXELGNMZSA-N |
| XLogP | 1.98 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|