C25H29NO7 — CID 20638298
5-O-[(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-methyl pentanedioate (PubChem CID 20638298) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 5-O-[(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-methyl pentanedioate.
| Compound Name | 5-O-[(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-methyl pentanedioate |
|---|---|
| PubChem CID | 20638298 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 5-O-[(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 1-O-methyl pentanedioate |
| SMILES | COC(=O)CCCC(=O)O[C@H]1C=C[C@H]2[C@H]3Cc4ccc(OC(C)=O)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C25H29NO7/c1-14(27)31-18-9-7-15-13-17-16-8-10-19(32-21(29)6-4-5-20(28)30-3)24-25(16,11-12-26(17)2)22(15)23(18)33-24/h7-10,16-17,19,24H,4-6,11-13H2,1-3H3/t16-,17+,19-,24-,25-/m0/s1 |
| InChIKey | FLXJWFYMCDKRQG-OAQLGNTPSA-N |
| XLogP | 2.31 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|