C27H26ClNO5 — CID 15384848
[(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-(4-chlorophenyl)acetate (PubChem CID 15384848) has the molecular formula C27H26ClNO5 and a molecular weight of 479.96 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-(4-chlorophenyl)acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 15384848 |
| Molecular Formula | C27H26ClNO5 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-(4-chlorophenyl)acetate |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](OC(=O)Cc4ccc(Cl)cc4)C=C[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C27H26ClNO5/c1-15(30)32-21-9-5-17-14-20-19-8-10-22(33-23(31)13-16-3-6-18(28)7-4-16)26-27(19,11-12-29(20)2)24(17)25(21)34-26/h3-10,19-20,22,26H,11-14H2,1-2H3/t19-,20+,22-,26-,27-/m0/s1 |
| InChIKey | DOWUUVLRRGWFLQ-HGYBVNBDSA-N |
| XLogP | 3.86 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|