C20H25NO3 — CID 58111562
[(4S,4aS,7aS,12bR)-3,9-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate (PubChem CID 58111562) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is [(4S,4aS,7aS,12bR)-3,9-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate.
| Compound Name | [(4S,4aS,7aS,12bR)-3,9-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 58111562 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [(4S,4aS,7aS,12bR)-3,9-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@H]2[C@@H]3Cc4ccc(C)c5c4[C@]2(CCN3C)[C@@H]1O5 |
| InChI | InChI=1S/C20H25NO3/c1-11-4-5-13-10-15-14-6-7-16(23-12(2)22)19-20(14,8-9-21(15)3)17(13)18(11)24-19/h4-5,14-16,19H,6-10H2,1-3H3/t14-,15+,16?,19-,20-/m1/s1 |
| InChIKey | FRZBOUMOTKPYOW-BXWZPQSNSA-N |
| XLogP | 2.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |