C22H24N2O3 — CID 67605258
(4R,4aR,7S,12bS)-3-methyl-7-pyridin-2-yloxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol (PubChem CID 67605258) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is (4R,4aR,7S,12bS)-3-methyl-7-pyridin-2-yloxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol.
| Compound Name | (4R,4aR,7S,12bS)-3-methyl-7-pyridin-2-yloxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
|---|---|
| PubChem CID | 67605258 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (4R,4aR,7S,12bS)-3-methyl-7-pyridin-2-yloxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4OC2[C@@H](Oc2ccccn2)CC[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C22H24N2O3/c1-24-11-9-22-14-6-8-17(26-18-4-2-3-10-23-18)21(22)27-20-16(25)7-5-13(19(20)22)12-15(14)24/h2-5,7,10,14-15,17,21,25H,6,8-9,11-12H2,1H3/t14-,15+,17-,21?,22-/m0/s1 |
| InChIKey | GIPJTSHXQFZDOZ-HHZOFZKNSA-N |
| XLogP | 2.90 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |