C26H30N2O3 — CID 58603883
(4S,4aR,7R,7aR,12bS)-7-(3,5-dihydro-2H-4,1-benzoxazepin-1-yl)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol (PubChem CID 58603883) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is (4S,4aR,7R,7aR,12bS)-7-(3,5-dihydro-2H-4,1-benzoxazepin-1-yl)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol.
| Compound Name | (4S,4aR,7R,7aR,12bS)-7-(3,5-dihydro-2H-4,1-benzoxazepin-1-yl)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
|---|---|
| PubChem CID | 58603883 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (4S,4aR,7R,7aR,12bS)-7-(3,5-dihydro-2H-4,1-benzoxazepin-1-yl)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@H](N2CCOCc4ccccc42)CC[C@H]3[C@@H]1C5 |
| InChI | InChI=1S/C26H30N2O3/c1-27-11-10-26-18-7-8-20(28-12-13-30-15-17-4-2-3-5-19(17)28)25(26)31-24-22(29)9-6-16(23(24)26)14-21(18)27/h2-6,9,18,20-21,25,29H,7-8,10-15H2,1H3/t18-,20+,21-,25-,26-/m0/s1 |
| InChIKey | NVNQYLUCZAAUJY-IPELTVPISA-N |
| XLogP | 3.47 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |