C24H34N2O5 — CID 87618429
tert-butyl 2-[[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methoxyamino]acetate (PubChem CID 87618429) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl 2-[[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methoxyamino]acetate.
| Compound Name | tert-butyl 2-[[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methoxyamino]acetate |
|---|---|
| PubChem CID | 87618429 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | tert-butyl 2-[[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methoxyamino]acetate |
| SMILES | CON(CC(=O)OC(C)(C)C)[C@H]1CC[C@H]2[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C24H34N2O5/c1-23(2,3)31-19(28)13-26(29-5)16-8-7-15-17-12-14-6-9-18(27)21-20(14)24(15,22(16)30-21)10-11-25(17)4/h6,9,15-17,22,27H,7-8,10-13H2,1-5H3/t15-,16-,17+,22-,24-/m0/s1 |
| InChIKey | XCRZVQZRHNIGMJ-JMIXGEDTSA-N |
| XLogP | 2.63 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|