C31H40N2O5 — CID 87761220
tert-butyl 3-[2-[[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methoxyamino]phenyl]propanoate (PubChem CID 87761220) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is tert-butyl 3-[2-[[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methoxyamino]phenyl]propanoate.
| Compound Name | tert-butyl 3-[2-[[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methoxyamino]phenyl]propanoate |
|---|---|
| PubChem CID | 87761220 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | tert-butyl 3-[2-[[(4R,4aR,7S,7aR,12bS)-9-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methoxyamino]phenyl]propanoate |
| SMILES | CON(c1ccccc1CCC(=O)OC(C)(C)C)[C@H]1CC[C@H]2[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C31H40N2O5/c1-30(2,3)38-26(35)15-11-19-8-6-7-9-22(19)33(36-5)23-13-12-21-24-18-20-10-14-25(34)28-27(20)31(21,29(23)37-28)16-17-32(24)4/h6-10,14,21,23-24,29,34H,11-13,15-18H2,1-5H3/t21-,23-,24+,29-,31-/m0/s1 |
| InChIKey | OIQWIQVCTHYDRA-HDOMGUSUSA-N |
| XLogP | 4.77 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|