C21H25NO4 — CID 130178188
[(1S,5R,13R,14S)-14-acetamido-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-10-yl] acetate (PubChem CID 130178188) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is [(1S,5R,13R,14S)-14-acetamido-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-10-yl] acetate.
| Compound Name | [(1S,5R,13R,14S)-14-acetamido-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-10-yl] acetate |
|---|---|
| PubChem CID | 130178188 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(1S,5R,13R,14S)-14-acetamido-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-10-yl] acetate |
| SMILES | CC(=O)N[C@H]1CCC2[C@@H]3CCC[C@@]24c2c(ccc(OC(C)=O)c2O[C@@H]14)C3 |
| InChI | InChI=1S/C21H25NO4/c1-11(23)22-16-7-6-15-13-4-3-9-21(15)18-14(10-13)5-8-17(25-12(2)24)19(18)26-20(16)21/h5,8,13,15-16,20H,3-4,6-7,9-10H2,1-2H3,(H,22,23)/t13-,15?,16+,20+,21+/m1/s1 |
| InChIKey | YTTDNYPXHGSESY-HJLBYNEZSA-N |
| XLogP | 2.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|