C22H28N2O4 — CID 123544213
(7-acetamido-3,11-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) acetate (PubChem CID 123544213) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (7-acetamido-3,11-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) acetate.
| Compound Name | (7-acetamido-3,11-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) acetate |
|---|---|
| PubChem CID | 123544213 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (7-acetamido-3,11-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) acetate |
| SMILES | CC(=O)NC1CCC2C3Cc4c(C)cc(OC(C)=O)c5c4C2(CCN3C)C1O5 |
| InChI | InChI=1S/C22H28N2O4/c1-11-9-18(27-13(3)26)20-19-14(11)10-17-15-5-6-16(23-12(2)25)21(28-20)22(15,19)7-8-24(17)4/h9,15-17,21H,5-8,10H2,1-4H3,(H,23,25) |
| InChIKey | HXCYZAAYLIMRSC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|